C19H22ClFN4O5S — CID 175547605
(cyclopentylideneamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate (PubChem CID 175547605) has the molecular formula C19H22ClFN4O5S and a molecular weight of 472.93 g/mol. Its IUPAC name is (cyclopentylideneamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate.
| Compound Name | (cyclopentylideneamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate |
|---|---|
| PubChem CID | 175547605 |
| Molecular Formula | C19H22ClFN4O5S |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (cyclopentylideneamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate |
| SMILES | CC(Oc1cc(N2C(=O)N(C)C(S)N(C)C2=O)c(F)cc1Cl)C(=O)ON=C1CCCC1 |
| InChI | InChI=1S/C19H22ClFN4O5S/c1-10(16(26)30-22-11-6-4-5-7-11)29-15-9-14(13(21)8-12(15)20)25-17(27)23(2)19(31)24(3)18(25)28/h8-10,19,31H,4-7H2,1-3H3 |
| InChIKey | HWRPSWQZPGYDJV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|