C20H17Cl2N3O2 — CID 18329950
2-(4-chlorophenyl)-7-(3-methoxyphenyl)-6-methyl-1H-pyrazolo[4,3-c]pyridin-3-one;hydrochloride (PubChem CID 18329950) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-(3-methoxyphenyl)-6-methyl-1H-pyrazolo[4,3-c]pyridin-3-one;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-7-(3-methoxyphenyl)-6-methyl-1H-pyrazolo[4,3-c]pyridin-3-one;hydrochloride |
|---|---|
| PubChem CID | 18329950 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-(4-chlorophenyl)-7-(3-methoxyphenyl)-6-methyl-1H-pyrazolo[4,3-c]pyridin-3-one;hydrochloride |
| SMILES | COc1cccc(-c2c(C)ncc3c(=O)n(-c4ccc(Cl)cc4)[nH]c23)c1.Cl |
| InChI | InChI=1S/C20H16ClN3O2.ClH/c1-12-18(13-4-3-5-16(10-13)26-2)19-17(11-22-12)20(25)24(23-19)15-8-6-14(21)7-9-15;/h3-11,23H,1-2H3;1H |
| InChIKey | KGQDRYCNWLUCOR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|