About 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one
2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one (PubChem CID 18334338) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one.
Analyze 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one?
The IUPAC name of 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one (CID 18334338) is 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one.
What is the SMILES notation for 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one?
The canonical SMILES for 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one is CCc1nc(NC)c(C)c(=O)n1C.
What is the InChIKey of 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one?
The InChIKey is VECLNGNMFSXSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5-7-11-8(10-3)6(2)9(13)12(7)4/h10H,5H2,1-4H3.
What are the key properties of 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one?
2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one has a molecular weight of 181.24 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,5-dimethyl-6-(methylamino)pyrimidin-4-one is sourced from PubChem (CID 18334338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).