About 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one
5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one (PubChem CID 18334367) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one.
Analyze 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one?
The IUPAC name of 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one (CID 18334367) is 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one.
What is the SMILES notation for 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one?
The canonical SMILES for 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one is CCc1c(NC)nc(C)n(C)c1=O.
What is the InChIKey of 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one?
The InChIKey is GNDWHYDRGXFNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5-7-8(10-3)11-6(2)12(4)9(7)13/h10H,5H2,1-4H3.
What are the key properties of 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one?
5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one has a molecular weight of 181.24 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dimethyl-6-(methylamino)pyrimidin-4-one is sourced from PubChem (CID 18334367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).