About 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one
3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one (PubChem CID 18334352) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one.
Analyze 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one?
The IUPAC name of 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one (CID 18334352) is 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one.
What is the SMILES notation for 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one?
The canonical SMILES for 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one is CCn1c(C)nc(NC)c(C)c1=O.
What is the InChIKey of 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one?
The InChIKey is QKHSYMRXBMVNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5-12-7(3)11-8(10-4)6(2)9(12)13/h10H,5H2,1-4H3.
What are the key properties of 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one?
3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one has a molecular weight of 181.24 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,5-dimethyl-6-(methylamino)pyrimidin-4-one is sourced from PubChem (CID 18334352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).