C9H15N3O — CID 18334378
6-(ethylamino)-2,3,5-trimethylpyrimidin-4-one (PubChem CID 18334378) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-(ethylamino)-2,3,5-trimethylpyrimidin-4-one.
| Compound Name | 6-(ethylamino)-2,3,5-trimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 18334378 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 6-(ethylamino)-2,3,5-trimethylpyrimidin-4-one |
| SMILES | CCNc1nc(C)n(C)c(=O)c1C |
| InChI | InChI=1S/C9H15N3O/c1-5-10-8-6(2)9(13)12(4)7(3)11-8/h10H,5H2,1-4H3 |
| InChIKey | YTAFNFAHHOXCCL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |