C31H31NO6S — CID 18335101
[4-[2-[4-[[3-[(4-ethanimidoylphenoxy)methyl]phenyl]methoxy]phenyl]propan-2-yl]phenyl] hydrogen sulfate (PubChem CID 18335101) has the molecular formula C31H31NO6S and a molecular weight of 545.66 g/mol. Its IUPAC name is [4-[2-[4-[[3-[(4-ethanimidoylphenoxy)methyl]phenyl]methoxy]phenyl]propan-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [4-[2-[4-[[3-[(4-ethanimidoylphenoxy)methyl]phenyl]methoxy]phenyl]propan-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 18335101 |
| Molecular Formula | C31H31NO6S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | [4-[2-[4-[[3-[(4-ethanimidoylphenoxy)methyl]phenyl]methoxy]phenyl]propan-2-yl]phenyl] hydrogen sulfate |
| SMILES | [H]/N=C(\C)c1ccc(OCc2cccc(COc3ccc(C(C)(C)c4ccc(OS(=O)(=O)O)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C31H31NO6S/c1-22(32)25-7-13-28(14-8-25)36-20-23-5-4-6-24(19-23)21-37-29-15-9-26(10-16-29)31(2,3)27-11-17-30(18-12-27)38-39(33,34)35/h4-19,32H,20-21H2,1-3H3,(H,33,34,35)/b32-22+ |
| InChIKey | ACXMWJKIJYAQFX-WEMUVCOSSA-N |
| XLogP | 6.74 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|