C14H23F3N4O3 — CID 18335501
1-(4,7-diacetyl-1,4,7,10-tetrazacyclododec-1-yl)-2,2,2-trifluoroethanone (PubChem CID 18335501) has the molecular formula C14H23F3N4O3 and a molecular weight of 352.36 g/mol. Its IUPAC name is 1-(4,7-diacetyl-1,4,7,10-tetrazacyclododec-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4,7-diacetyl-1,4,7,10-tetrazacyclododec-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 18335501 |
| Molecular Formula | C14H23F3N4O3 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-(4,7-diacetyl-1,4,7,10-tetrazacyclododec-1-yl)-2,2,2-trifluoroethanone |
| SMILES | CC(=O)N1CCNCCN(C(=O)C(F)(F)F)CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C14H23F3N4O3/c1-11(22)19-5-3-18-4-6-21(13(24)14(15,16)17)10-9-20(8-7-19)12(2)23/h18H,3-10H2,1-2H3 |
| InChIKey | HSGLOBOKQWSCRK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |