C10H16F6N4O2 — CID 15938557
2,2,2-trifluoro-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethylamino]ethyl]acetamide (PubChem CID 15938557) has the molecular formula C10H16F6N4O2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethylamino]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 15938557 |
| Molecular Formula | C10H16F6N4O2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethylamino]ethyl]acetamide |
| SMILES | O=C(NCCNCCNCCNC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16F6N4O2/c11-9(12,13)7(21)19-5-3-17-1-2-18-4-6-20-8(22)10(14,15)16/h17-18H,1-6H2,(H,19,21)(H,20,22) |
| InChIKey | KZYWBHHMDVXULL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|