C19H36N6O3 — CID 18338831
N-butyl-5-[3-(diaminomethylideneamino)propyl]-1-hexyl-3,6-dioxopiperazine-2-carboxamide (PubChem CID 18338831) has the molecular formula C19H36N6O3 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-butyl-5-[3-(diaminomethylideneamino)propyl]-1-hexyl-3,6-dioxopiperazine-2-carboxamide.
| Compound Name | N-butyl-5-[3-(diaminomethylideneamino)propyl]-1-hexyl-3,6-dioxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18338831 |
| Molecular Formula | C19H36N6O3 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | N-butyl-5-[3-(diaminomethylideneamino)propyl]-1-hexyl-3,6-dioxopiperazine-2-carboxamide |
| SMILES | CCCCCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1C(=O)NCCCC |
| InChI | InChI=1S/C19H36N6O3/c1-3-5-7-8-13-25-15(16(26)22-11-6-4-2)17(27)24-14(18(25)28)10-9-12-23-19(20)21/h14-15H,3-13H2,1-2H3,(H,22,26)(H,24,27)(H4,20,21,23) |
| InChIKey | KXOXFBFXBGCFGD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|