C5H8N2Na2O5S2 — CID 18341757
disodium;2-(2-sulfonatoethylcarbamothioylamino)acetate (PubChem CID 18341757) has the molecular formula C5H8N2Na2O5S2 and a molecular weight of 286.24 g/mol. Its IUPAC name is disodium;2-(2-sulfonatoethylcarbamothioylamino)acetate.
| Compound Name | disodium;2-(2-sulfonatoethylcarbamothioylamino)acetate |
|---|---|
| PubChem CID | 18341757 |
| Molecular Formula | C5H8N2Na2O5S2 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | disodium;2-(2-sulfonatoethylcarbamothioylamino)acetate |
| SMILES | O=C([O-])CNC(=S)NCCS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H10N2O5S2.2Na/c8-4(9)3-7-5(13)6-1-2-14(10,11)12;;/h1-3H2,(H,8,9)(H2,6,7,13)(H,10,11,12);;/q;2*+1/p-2 |
| InChIKey | URSHASFTHZAVOF-UHFFFAOYSA-L |
| XLogP | -9.25 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|