C14H15FO6 — CID 18341888
3-O-(fluoromethyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 18341888) has the molecular formula C14H15FO6 and a molecular weight of 298.27 g/mol. Its IUPAC name is 3-O-(fluoromethyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexa-3,5-diene-1,3-dicarboxylate.
| Compound Name | 3-O-(fluoromethyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexa-3,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18341888 |
| Molecular Formula | C14H15FO6 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-O-(fluoromethyl) 1-O-(2-prop-2-enoyloxyethyl) cyclohexa-3,5-diene-1,3-dicarboxylate |
| SMILES | C=CC(=O)OCCOC(=O)C1C=CC=C(C(=O)OCF)C1 |
| InChI | InChI=1S/C14H15FO6/c1-2-12(16)19-6-7-20-13(17)10-4-3-5-11(8-10)14(18)21-9-15/h2-5,10H,1,6-9H2 |
| InChIKey | NSNWIBURMXLHKD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|