C10H6O3 — CID 18349269
1-benzofuran-2,5-dicarbaldehyde (PubChem CID 18349269) has the molecular formula C10H6O3 and a molecular weight of 174.15 g/mol. Its IUPAC name is 1-benzofuran-2,5-dicarbaldehyde.
| Compound Name | 1-benzofuran-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 18349269 |
| Molecular Formula | C10H6O3 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 1-benzofuran-2,5-dicarbaldehyde |
| SMILES | O=Cc1ccc2oc(C=O)cc2c1 |
| InChI | InChI=1S/C10H6O3/c11-5-7-1-2-10-8(3-7)4-9(6-12)13-10/h1-6H |
| InChIKey | CWHUCBQOJWVGEF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|