C42H50Cl2N2O9 — CID 18352960
cyclohexyl-[4-[[1-(3,4-dichlorophenyl)propan-2-yl-ethylamino]methyl]piperidin-1-yl]methanone;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid (PubChem CID 18352960) has the molecular formula C42H50Cl2N2O9 and a molecular weight of 797.77 g/mol. Its IUPAC name is cyclohexyl-[4-[[1-(3,4-dichlorophenyl)propan-2-yl-ethylamino]methyl]piperidin-1-yl]methanone;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid.
| Compound Name | cyclohexyl-[4-[[1-(3,4-dichlorophenyl)propan-2-yl-ethylamino]methyl]piperidin-1-yl]methanone;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 18352960 |
| Molecular Formula | C42H50Cl2N2O9 |
| Molecular Weight | 797.77 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | cyclohexyl-[4-[[1-(3,4-dichlorophenyl)propan-2-yl-ethylamino]methyl]piperidin-1-yl]methanone;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid |
| SMILES | CCN(CC1CCN(C(=O)C2CCCCC2)CC1)C(C)Cc1ccc(Cl)c(Cl)c1.O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H36Cl2N2O.C18H14O8/c1-3-27(18(2)15-20-9-10-22(25)23(26)16-20)17-19-11-13-28(14-12-19)24(29)21-7-5-4-6-8-21;19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12/h9-10,16,18-19,21H,3-8,11-15,17H2,1-2H3;1-10,25-26H,(H,21,22)(H,23,24) |
| InChIKey | FJNYMXZSYPSQBI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 172.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|