C17H8F6N2O3 — CID 18358830
1-[4-(1,1,2,2,3,3-hexafluoropropyl)phenoxy]-2,3-diisocyanatobenzene (PubChem CID 18358830) has the molecular formula C17H8F6N2O3 and a molecular weight of 402.25 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,3,3-hexafluoropropyl)phenoxy]-2,3-diisocyanatobenzene.
| Compound Name | 1-[4-(1,1,2,2,3,3-hexafluoropropyl)phenoxy]-2,3-diisocyanatobenzene |
|---|---|
| PubChem CID | 18358830 |
| Molecular Formula | C17H8F6N2O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 1-[4-(1,1,2,2,3,3-hexafluoropropyl)phenoxy]-2,3-diisocyanatobenzene |
| SMILES | O=C=Nc1cccc(Oc2ccc(C(F)(F)C(F)(F)C(F)F)cc2)c1N=C=O |
| InChI | InChI=1S/C17H8F6N2O3/c18-15(19)17(22,23)16(20,21)10-4-6-11(7-5-10)28-13-3-1-2-12(24-8-26)14(13)25-9-27/h1-7,15H |
| InChIKey | YWYROKRQAHZVAD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|