C18H26O8-2 — CID 18359664
4-hydroxybutyl prop-2-enoate;(E)-2-methylbut-2-enoate;2-(oxiran-2-ylmethyl)prop-2-enoate (PubChem CID 18359664) has the molecular formula C18H26O8-2 and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-hydroxybutyl prop-2-enoate;(E)-2-methylbut-2-enoate;2-(oxiran-2-ylmethyl)prop-2-enoate.
| Compound Name | 4-hydroxybutyl prop-2-enoate;(E)-2-methylbut-2-enoate;2-(oxiran-2-ylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 18359664 |
| Molecular Formula | C18H26O8-2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-hydroxybutyl prop-2-enoate;(E)-2-methylbut-2-enoate;2-(oxiran-2-ylmethyl)prop-2-enoate |
| SMILES | C/C=C(\C)C(=O)[O-].C=C(CC1CO1)C(=O)[O-].C=CC(=O)OCCCCO |
| InChI | InChI=1S/C7H12O3.C6H8O3.C5H8O2/c1-2-7(9)10-6-4-3-5-8;1-4(6(7)8)2-5-3-9-5;1-3-4(2)5(6)7/h2,8H,1,3-6H2;5H,1-3H2,(H,7,8);3H,1-2H3,(H,6,7)/p-2/b;;4-3+ |
| InChIKey | XHOVCKBYAHUZRD-VJJINTEWSA-L |
| XLogP | -0.73 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|