C7H4F2N2O2S — CID 18361903
1-cyano-4,5-difluoro-2-(sulfinoamino)benzene (PubChem CID 18361903) has the molecular formula C7H4F2N2O2S and a molecular weight of 218.18 g/mol. Its IUPAC name is 1-cyano-4,5-difluoro-2-(sulfinoamino)benzene.
| Compound Name | 1-cyano-4,5-difluoro-2-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 18361903 |
| Molecular Formula | C7H4F2N2O2S |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 1-cyano-4,5-difluoro-2-(sulfinoamino)benzene |
| SMILES | N#Cc1cc(F)c(F)cc1NS(=O)O |
| InChI | InChI=1S/C7H4F2N2O2S/c8-5-1-4(3-10)7(2-6(5)9)11-14(12)13/h1-2,11H,(H,12,13) |
| InChIKey | WEPXKZXPSZKYAQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|