C19H25BrN2O2 — CID 18371437
2-[2-(bromomethyl)phenyl]-4-N,4-N-bis(2-methoxyethyl)benzene-1,4-diamine (PubChem CID 18371437) has the molecular formula C19H25BrN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 2-[2-(bromomethyl)phenyl]-4-N,4-N-bis(2-methoxyethyl)benzene-1,4-diamine.
| Compound Name | 2-[2-(bromomethyl)phenyl]-4-N,4-N-bis(2-methoxyethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 18371437 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[2-(bromomethyl)phenyl]-4-N,4-N-bis(2-methoxyethyl)benzene-1,4-diamine |
| SMILES | COCCN(CCOC)c1ccc(N)c(-c2ccccc2CBr)c1 |
| InChI | InChI=1S/C19H25BrN2O2/c1-23-11-9-22(10-12-24-2)16-7-8-19(21)18(13-16)17-6-4-3-5-15(17)14-20/h3-8,13H,9-12,14,21H2,1-2H3 |
| InChIKey | SUKSOBWZCXJNDQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|