C30H50N4O6 — CID 123557475
5-[bis(2-methoxyethyl)amino]-2-[[3-[[4-[bis(2-methoxyethyl)amino]-2-hydroxyphenyl]methylamino]butan-2-ylamino]methyl]phenol (PubChem CID 123557475) has the molecular formula C30H50N4O6 and a molecular weight of 562.75 g/mol. Its IUPAC name is 5-[bis(2-methoxyethyl)amino]-2-[[3-[[4-[bis(2-methoxyethyl)amino]-2-hydroxyphenyl]methylamino]butan-2-ylamino]methyl]phenol.
| Compound Name | 5-[bis(2-methoxyethyl)amino]-2-[[3-[[4-[bis(2-methoxyethyl)amino]-2-hydroxyphenyl]methylamino]butan-2-ylamino]methyl]phenol |
|---|---|
| PubChem CID | 123557475 |
| Molecular Formula | C30H50N4O6 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | 5-[bis(2-methoxyethyl)amino]-2-[[3-[[4-[bis(2-methoxyethyl)amino]-2-hydroxyphenyl]methylamino]butan-2-ylamino]methyl]phenol |
| SMILES | COCCN(CCOC)c1ccc(CNC(C)C(C)NCc2ccc(N(CCOC)CCOC)cc2O)c(O)c1 |
| InChI | InChI=1S/C30H50N4O6/c1-23(31-21-25-7-9-27(19-29(25)35)33(11-15-37-3)12-16-38-4)24(2)32-22-26-8-10-28(20-30(26)36)34(13-17-39-5)14-18-40-6/h7-10,19-20,23-24,31-32,35-36H,11-18,21-22H2,1-6H3 |
| InChIKey | HAILGVOANUHRJN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|