C19H11Cl3N2O3S — CID 18376694
3-chloro-N-[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl]-5-formylthiophene-2-carboxamide (PubChem CID 18376694) has the molecular formula C19H11Cl3N2O3S and a molecular weight of 453.73 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl]-5-formylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl]-5-formylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18376694 |
| Molecular Formula | C19H11Cl3N2O3S |
| Molecular Weight | 453.73 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | 3-chloro-N-[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl]-5-formylthiophene-2-carboxamide |
| SMILES | O=Cc1cc(Cl)c(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C19H11Cl3N2O3S/c20-10-1-4-12(5-2-10)23-18(26)14-7-11(21)3-6-16(14)24-19(27)17-15(22)8-13(9-25)28-17/h1-9H,(H,23,26)(H,24,27) |
| InChIKey | TXFFTXXRRPKZAT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|