C15H11NO2 — CID 18380752
bicyclo[2.2.0]hexa-1,3,5-triene;(2-ethynylphenyl)carbamic acid (PubChem CID 18380752) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;(2-ethynylphenyl)carbamic acid.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;(2-ethynylphenyl)carbamic acid |
|---|---|
| PubChem CID | 18380752 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;(2-ethynylphenyl)carbamic acid |
| SMILES | C#Cc1ccccc1NC(=O)O.c1cc2ccc1-2 |
| InChI | InChI=1S/C9H7NO2.C6H4/c1-2-7-5-3-4-6-8(7)10-9(11)12;1-2-6-4-3-5(1)6/h1,3-6,10H,(H,11,12);1-4H |
| InChIKey | QINKRFLCFVOKAP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|