C19H16ClN3S — CID 18382752
7-chloro-2-[6-(2,5-dimethylpyrrol-1-yl)-2-methyl-3-pyridinyl]thieno[3,2-b]pyridine (PubChem CID 18382752) has the molecular formula C19H16ClN3S and a molecular weight of 353.88 g/mol. Its IUPAC name is 7-chloro-2-[6-(2,5-dimethylpyrrol-1-yl)-2-methyl-3-pyridinyl]thieno[3,2-b]pyridine.
| Compound Name | 7-chloro-2-[6-(2,5-dimethylpyrrol-1-yl)-2-methyl-3-pyridinyl]thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 18382752 |
| Molecular Formula | C19H16ClN3S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 7-chloro-2-[6-(2,5-dimethylpyrrol-1-yl)-2-methyl-3-pyridinyl]thieno[3,2-b]pyridine |
| SMILES | Cc1nc(-n2c(C)ccc2C)ccc1-c1cc2nccc(Cl)c2s1 |
| InChI | InChI=1S/C19H16ClN3S/c1-11-4-5-12(2)23(11)18-7-6-14(13(3)22-18)17-10-16-19(24-17)15(20)8-9-21-16/h4-10H,1-3H3 |
| InChIKey | OFSNMVXAGPOBDU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|