C21H23N4S+ — CID 10719857
8-(4-benzyl-4-methylpiperazin-4-ium-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 10719857) has the molecular formula C21H23N4S+ and a molecular weight of 363.51 g/mol. Its IUPAC name is 8-(4-benzyl-4-methylpiperazin-4-ium-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-(4-benzyl-4-methylpiperazin-4-ium-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 10719857 |
| Molecular Formula | C21H23N4S+ |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 8-(4-benzyl-4-methylpiperazin-4-ium-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | C[N+]1(Cc2ccccc2)CCN(c2nc3ccsc3n3cccc23)CC1 |
| InChI | InChI=1S/C21H23N4S/c1-25(16-17-6-3-2-4-7-17)13-11-23(12-14-25)20-19-8-5-10-24(19)21-18(22-20)9-15-26-21/h2-10,15H,11-14,16H2,1H3/q+1 |
| InChIKey | CHXZPUOMGXBHFG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|