C33H37N3O5S — CID 18386229
3-[4-[2-(1-aminocyclohexyl)ethynyl]phenyl]-2-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 18386229) has the molecular formula C33H37N3O5S and a molecular weight of 587.74 g/mol. Its IUPAC name is 3-[4-[2-(1-aminocyclohexyl)ethynyl]phenyl]-2-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[4-[2-(1-aminocyclohexyl)ethynyl]phenyl]-2-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18386229 |
| Molecular Formula | C33H37N3O5S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 3-[4-[2-(1-aminocyclohexyl)ethynyl]phenyl]-2-[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)NC(Cc2ccc(C#CC3(N)CCCCC3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C33H37N3O5S/c1-24-10-16-28(17-11-24)42(40,41)36-29(22-26-8-4-2-5-9-26)31(37)35-30(32(38)39)23-27-14-12-25(13-15-27)18-21-33(34)19-6-3-7-20-33/h2,4-5,8-17,29-30,36H,3,6-7,19-20,22-23,34H2,1H3,(H,35,37)(H,38,39) |
| InChIKey | HNCBBTIGJVNOQL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|