C12H16N2O2 — CID 18388229
6-[(E)-4-(methylamino)but-1-enyl]-1,3-benzodioxol-4-amine (PubChem CID 18388229) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-[(E)-4-(methylamino)but-1-enyl]-1,3-benzodioxol-4-amine.
| Compound Name | 6-[(E)-4-(methylamino)but-1-enyl]-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 18388229 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 6-[(E)-4-(methylamino)but-1-enyl]-1,3-benzodioxol-4-amine |
| SMILES | CNCC/C=C/c1cc(N)c2c(c1)OCO2 |
| InChI | InChI=1S/C12H16N2O2/c1-14-5-3-2-4-9-6-10(13)12-11(7-9)15-8-16-12/h2,4,6-7,14H,3,5,8,13H2,1H3/b4-2+ |
| InChIKey | KZCXAMXHUWUJQH-DUXPYHPUSA-N |
| XLogP | 1.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|