C11H16N2O — CID 18391691
2-methyl-5-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine (PubChem CID 18391691) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-methyl-5-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine.
| Compound Name | 2-methyl-5-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 18391691 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-methyl-5-[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine |
| SMILES | Cc1ccc(OC[C@@H]2CCN2C)cn1 |
| InChI | InChI=1S/C11H16N2O/c1-9-3-4-11(7-12-9)14-8-10-5-6-13(10)2/h3-4,7,10H,5-6,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | WZMZNRXJOIJXKV-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |