C13H17ClN2O — CID 22961888
2-chloro-5-[[(2S)-1-methylazetidin-2-yl]methoxy]-3-prop-2-enylpyridine (PubChem CID 22961888) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-chloro-5-[[(2S)-1-methylazetidin-2-yl]methoxy]-3-prop-2-enylpyridine.
| Compound Name | 2-chloro-5-[[(2S)-1-methylazetidin-2-yl]methoxy]-3-prop-2-enylpyridine |
|---|---|
| PubChem CID | 22961888 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-chloro-5-[[(2S)-1-methylazetidin-2-yl]methoxy]-3-prop-2-enylpyridine |
| SMILES | C=CCc1cc(OC[C@@H]2CCN2C)cnc1Cl |
| InChI | InChI=1S/C13H17ClN2O/c1-3-4-10-7-12(8-15-13(10)14)17-9-11-5-6-16(11)2/h3,7-8,11H,1,4-6,9H2,2H3/t11-/m0/s1 |
| InChIKey | XMKSMECRKAGNQA-NSHDSACASA-N |
| XLogP | 2.55 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|