C23H35N6O3+ — CID 18408662
4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-ium-1-yl]benzenecarboximidamide (PubChem CID 18408662) has the molecular formula C23H35N6O3+ and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-ium-1-yl]benzenecarboximidamide.
| Compound Name | 4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-ium-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18408662 |
| Molecular Formula | C23H35N6O3+ |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-ium-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([N+]2(C3(CCCCCCCC)C(=O)NC(=O)NC3=O)CCNCC2)cc1 |
| InChI | InChI=1S/C23H34N6O3/c1-2-3-4-5-6-7-12-23(20(30)27-22(32)28-21(23)31)29(15-13-26-14-16-29)18-10-8-17(9-11-18)19(24)25/h8-11,26H,2-7,12-16H2,1H3,(H4-,24,25,27,28,30,31,32)/p+1 |
| InChIKey | WBCBYAPPYXHCPM-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|