C29H25N3O3 — CID 18414475
2-[6-[2-methoxy-4-[(2-phenylethylamino)methyl]phenyl]-2-pyridinyl]isoindole-1,3-dione (PubChem CID 18414475) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[6-[2-methoxy-4-[(2-phenylethylamino)methyl]phenyl]-2-pyridinyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[2-methoxy-4-[(2-phenylethylamino)methyl]phenyl]-2-pyridinyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18414475 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[6-[2-methoxy-4-[(2-phenylethylamino)methyl]phenyl]-2-pyridinyl]isoindole-1,3-dione |
| SMILES | COc1cc(CNCCc2ccccc2)ccc1-c1cccc(N2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C29H25N3O3/c1-35-26-18-21(19-30-17-16-20-8-3-2-4-9-20)14-15-24(26)25-12-7-13-27(31-25)32-28(33)22-10-5-6-11-23(22)29(32)34/h2-15,18,30H,16-17,19H2,1H3 |
| InChIKey | IAMSIXANQYAJPC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|