C14H10F21NO2S — CID 18421315
N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonamide (PubChem CID 18421315) has the molecular formula C14H10F21NO2S and a molecular weight of 655.26 g/mol. Its IUPAC name is N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonamide.
| Compound Name | N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonamide |
|---|---|
| PubChem CID | 18421315 |
| Molecular Formula | C14H10F21NO2S |
| Molecular Weight | 655.26 g/mol |
| Exact Mass | 655.01 |
| IUPAC Name | N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F21NO2S/c1-3-36(4-2)39(37,38)14(34,35)12(29,30)10(25,26)8(21,22)6(17,18)5(15,16)7(19,20)9(23,24)11(27,28)13(31,32)33/h3-4H2,1-2H3 |
| InChIKey | NHIKKIFSTDTVDQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.26 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|