C13H10N2O2S — CID 18427448
N-(furan-2-yl)-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 18427448) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is N-(furan-2-yl)-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(furan-2-yl)-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 18427448 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | N-(furan-2-yl)-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | O=C(Nc1ccco1)C1=CNc2ccccc2S1 |
| InChI | InChI=1S/C13H10N2O2S/c16-13(15-12-6-3-7-17-12)11-8-14-9-4-1-2-5-10(9)18-11/h1-8,14H,(H,15,16) |
| InChIKey | FENIMOAMQBHYQQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|