C18H17ClN2O4 — CID 18433521
[1-[(3-chlorophenyl)-(3-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]carbamic acid (PubChem CID 18433521) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is [1-[(3-chlorophenyl)-(3-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[(3-chlorophenyl)-(3-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 18433521 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [1-[(3-chlorophenyl)-(3-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(C(c2cccc(O)c2)c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H17ClN2O4/c19-13-5-1-3-11(9-13)16(12-4-2-6-14(22)10-12)21-8-7-15(17(21)23)20-18(24)25/h1-6,9-10,15-16,20,22H,7-8H2,(H,24,25) |
| InChIKey | PGMBDYZESJSLIP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |