C12H9ClN2O6S — CID 18434589
methyl 3-chloro-2-(1,2-oxazole-5-carbonylsulfamoyl)benzoate (PubChem CID 18434589) has the molecular formula C12H9ClN2O6S and a molecular weight of 344.73 g/mol. Its IUPAC name is methyl 3-chloro-2-(1,2-oxazole-5-carbonylsulfamoyl)benzoate.
| Compound Name | methyl 3-chloro-2-(1,2-oxazole-5-carbonylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18434589 |
| Molecular Formula | C12H9ClN2O6S |
| Molecular Weight | 344.73 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | methyl 3-chloro-2-(1,2-oxazole-5-carbonylsulfamoyl)benzoate |
| SMILES | COC(=O)c1cccc(Cl)c1S(=O)(=O)NC(=O)c1ccno1 |
| InChI | InChI=1S/C12H9ClN2O6S/c1-20-12(17)7-3-2-4-8(13)10(7)22(18,19)15-11(16)9-5-6-14-21-9/h2-6H,1H3,(H,15,16) |
| InChIKey | BRUCKYKFPAFTRH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |