C26H23ClN4O — CID 18436120
6-(4-chlorophenyl)-N-[3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]pyridine-3-carboxamide (PubChem CID 18436120) has the molecular formula C26H23ClN4O and a molecular weight of 442.95 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-[3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]pyridine-3-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-[3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18436120 |
| Molecular Formula | C26H23ClN4O |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 6-(4-chlorophenyl)-N-[3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2cc(CN3CCCC3)cnc2c1)c1ccc(-c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C26H23ClN4O/c27-22-7-3-19(4-8-22)24-10-6-21(16-29-24)26(32)30-23-9-5-20-13-18(15-28-25(20)14-23)17-31-11-1-2-12-31/h3-10,13-16H,1-2,11-12,17H2,(H,30,32) |
| InChIKey | CCQQMKPBDIACQQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |