About N-(4-oxobutyl)carbamate
N-(4-oxobutyl)carbamate (PubChem CID 18436941) has the molecular formula C5H8NO3-
and a molecular weight of 130.12 g/mol. Its IUPAC name is N-(4-oxobutyl)carbamate.
Molecular Properties
| Compound Name | N-(4-oxobutyl)carbamate |
| PubChem CID | 18436941 |
| Molecular Formula | C5H8NO3- |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | N-(4-oxobutyl)carbamate |
| SMILES | O=CCCCNC(=O)[O-] |
| InChI | InChI=1S/C5H9NO3/c7-4-2-1-3-6-5(8)9/h4,6H,1-3H2,(H,8,9)/p-1 |
| InChIKey | MKFFYSXIRQMYKC-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-oxobutyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-oxobutyl)carbamate?
The IUPAC name of N-(4-oxobutyl)carbamate (CID 18436941) is N-(4-oxobutyl)carbamate.
What is the SMILES notation for N-(4-oxobutyl)carbamate?
The canonical SMILES for N-(4-oxobutyl)carbamate is O=CCCCNC(=O)[O-].
What is the InChIKey of N-(4-oxobutyl)carbamate?
The InChIKey is MKFFYSXIRQMYKC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9NO3/c7-4-2-1-3-6-5(8)9/h4,6H,1-3H2,(H,8,9)/p-1.
What are the key properties of N-(4-oxobutyl)carbamate?
N-(4-oxobutyl)carbamate has a molecular weight of 130.12 g/mol, XLogP of -1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-oxobutyl)carbamate is sourced from PubChem (CID 18436941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).