C13H13N3O6 — CID 18442328
[3-(carboxyamino)-2-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid (PubChem CID 18442328) has the molecular formula C13H13N3O6 and a molecular weight of 307.26 g/mol. Its IUPAC name is [3-(carboxyamino)-2-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid.
| Compound Name | [3-(carboxyamino)-2-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid |
|---|---|
| PubChem CID | 18442328 |
| Molecular Formula | C13H13N3O6 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [3-(carboxyamino)-2-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid |
| SMILES | O=C(O)NCC(CNC(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13N3O6/c17-10-8-3-1-2-4-9(8)11(18)16(10)7(5-14-12(19)20)6-15-13(21)22/h1-4,7,14-15H,5-6H2,(H,19,20)(H,21,22) |
| InChIKey | NKRRBVCFZDOSDW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|