C7H17ClN2 — CID 18442858
trans-(1R,2R)-cycloheptane-1,2-diamine;hydrochloride (PubChem CID 18442858) has the molecular formula C7H17ClN2 and a molecular weight of 164.68 g/mol. Its IUPAC name is trans-(1R,2R)-cycloheptane-1,2-diamine;hydrochloride.
| Compound Name | trans-(1R,2R)-cycloheptane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 18442858 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | trans-(1R,2R)-cycloheptane-1,2-diamine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCCCC[C@H]1N |
| InChI | InChI=1S/C7H16N2.ClH/c8-6-4-2-1-3-5-7(6)9;/h6-7H,1-5,8-9H2;1H/t6-,7-;/m1./s1 |
| InChIKey | QEACAZYQQRVGBZ-ZJLYAJKPSA-N |
| XLogP | 1.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |