C33H59N9O13 — CID 18444213
2-[[6-amino-2-[[2-[[6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 18444213) has the molecular formula C33H59N9O13 and a molecular weight of 789.88 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18444213 |
| Molecular Formula | C33H59N9O13 |
| Molecular Weight | 789.88 g/mol |
| Exact Mass | 789.42 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[6-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(=O)O)NC(=O)C(N)C(C)O)C(=O)NC(CCCCN)C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C33H59N9O13/c1-4-17(2)27(42-30(51)22(15-25(47)48)41-31(52)26(36)18(3)43)32(53)39-19(9-5-7-13-34)28(49)37-16-23(44)38-20(10-6-8-14-35)29(50)40-21(33(54)55)11-12-24(45)46/h17-22,26-27,43H,4-16,34-36H2,1-3H3,(H,37,49)(H,38,44)(H,39,53)(H,40,50)(H,41,52)(H,42,51)(H,45,46)(H,47,48)(H,54,55) |
| InChIKey | LJPJLRNOSNUOFP-UHFFFAOYSA-N |
| XLogP | -4.04 |
| TPSA | 384.79 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.88 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|