C17H18F2N4O2S — CID 18444840
N-cyclopropyl-5-[(2,6-difluoro-3,5-dimethoxyphenyl)iminomethyl]-2-methylsulfanylpyrimidin-4-amine (PubChem CID 18444840) has the molecular formula C17H18F2N4O2S and a molecular weight of 380.42 g/mol. Its IUPAC name is N-cyclopropyl-5-[(2,6-difluoro-3,5-dimethoxyphenyl)iminomethyl]-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-cyclopropyl-5-[(2,6-difluoro-3,5-dimethoxyphenyl)iminomethyl]-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 18444840 |
| Molecular Formula | C17H18F2N4O2S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-cyclopropyl-5-[(2,6-difluoro-3,5-dimethoxyphenyl)iminomethyl]-2-methylsulfanylpyrimidin-4-amine |
| SMILES | COc1cc(OC)c(F)c(/N=C/c2cnc(SC)nc2NC2CC2)c1F |
| InChI | InChI=1S/C17H18F2N4O2S/c1-24-11-6-12(25-2)14(19)15(13(11)18)20-7-9-8-21-17(26-3)23-16(9)22-10-4-5-10/h6-8,10H,4-5H2,1-3H3,(H,21,22,23)/b20-7+ |
| InChIKey | ZNCDMBWCYQGZTH-IFRROFPPSA-N |
| XLogP | 3.82 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|