C12H14Cl2N2O3S — CID 18445248
4-amino-1-(3,4-dichlorophenyl)sulfonylazepan-3-one (PubChem CID 18445248) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 4-amino-1-(3,4-dichlorophenyl)sulfonylazepan-3-one.
| Compound Name | 4-amino-1-(3,4-dichlorophenyl)sulfonylazepan-3-one |
|---|---|
| PubChem CID | 18445248 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-amino-1-(3,4-dichlorophenyl)sulfonylazepan-3-one |
| SMILES | NC1CCCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1=O |
| InChI | InChI=1S/C12H14Cl2N2O3S/c13-9-4-3-8(6-10(9)14)20(18,19)16-5-1-2-11(15)12(17)7-16/h3-4,6,11H,1-2,5,7,15H2 |
| InChIKey | UGIDPXVGDJQFHG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |