C27H30ClF7N2O2 — CID 18445907
(3R,5R)-3-(aminomethyl)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one;hydrochloride (PubChem CID 18445907) has the molecular formula C27H30ClF7N2O2 and a molecular weight of 582.99 g/mol. Its IUPAC name is (3R,5R)-3-(aminomethyl)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one;hydrochloride.
| Compound Name | (3R,5R)-3-(aminomethyl)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 18445907 |
| Molecular Formula | C27H30ClF7N2O2 |
| Molecular Weight | 582.99 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | (3R,5R)-3-(aminomethyl)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one;hydrochloride |
| SMILES | C[C@@H](O[C@H]1CC[C@@H]([C@H]2C[C@](C)(CN)C(=O)N2)[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C27H29F7N2O2.ClH/c1-14(16-9-17(26(29,30)31)11-18(10-16)27(32,33)34)38-22-8-7-20(21-12-25(2,13-35)24(37)36-21)23(22)15-3-5-19(28)6-4-15;/h3-6,9-11,14,20-23H,7-8,12-13,35H2,1-2H3,(H,36,37);1H/t14-,20+,21-,22+,23+,25-;/m1./s1 |
| InChIKey | IJFQADDWSLVQRE-ILDWBAMNSA-N |
| XLogP | 6.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.99 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |