C8H6F6 — CID 18446165
1,5-bis(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 18446165) has the molecular formula C8H6F6 and a molecular weight of 216.12 g/mol. Its IUPAC name is 1,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 1,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 18446165 |
| Molecular Formula | C8H6F6 |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C1=CC=CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H6F6/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14/h1-3,5H,4H2 |
| InChIKey | ZJVYLFYBJWMOTN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |