C18H21N5O3 — CID 18447904
(7aS)-1,3-dioxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 18447904) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is (7aS)-1,3-dioxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aS)-1,3-dioxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 18447904 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (7aS)-1,3-dioxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | [H]/N=C(/c1ccc(N2C(=O)N3CCC[C@]3(C(N)=O)C2=O)cc1)N1CCCC1 |
| InChI | InChI=1S/C18H21N5O3/c19-14(21-9-1-2-10-21)12-4-6-13(7-5-12)23-16(25)18(15(20)24)8-3-11-22(18)17(23)26/h4-7,19H,1-3,8-11H2,(H2,20,24)/b19-14-/t18-/m0/s1 |
| InChIKey | VFHJXULREWUZRW-OWBBTNHHSA-N |
| XLogP | 0.89 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|