8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid

C25H29N3O2 — CID 18452661

IUPAC8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid
SMILESCN(CCCCCCCC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1
InChIInChI=1S/C25H29N3O2/c1-28(18-12-4-2-3-11-17-23(29)30)22-19-26-24(20-13-7-5-8-14-20)25(27-22)21-15-9-6-10-16-21/h5-10,13-16,19H,2-4,11-12,17-18H2,1H3,(H,29,30)
InChIKeyGKOHHJQMBKJZDT-UHFFFAOYSA-N
MW403.53 g/mol
LogP5.67
Rot. Bonds11

About 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid

8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid (PubChem CID 18452661) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid.

Molecular Properties

Compound Name8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid
PubChem CID18452661
Molecular FormulaC25H29N3O2
Molecular Weight403.53 g/mol
Exact Mass403.23
IUPAC Name8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid
SMILESCN(CCCCCCCC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1
InChIInChI=1S/C25H29N3O2/c1-28(18-12-4-2-3-11-17-23(29)30)22-19-26-24(20-13-7-5-8-14-20)25(27-22)21-15-9-6-10-16-21/h5-10,13-16,19H,2-4,11-12,17-18H2,1H3,(H,29,30)
InChIKeyGKOHHJQMBKJZDT-UHFFFAOYSA-N
XLogP5.67
TPSA66.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds11
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500403.53
LogP ≤ 55.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid?
The IUPAC name of 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid (CID 18452661) is 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid.
What is the SMILES notation for 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid?
The canonical SMILES for 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid is CN(CCCCCCCC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid?
The InChIKey is GKOHHJQMBKJZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O2/c1-28(18-12-4-2-3-11-17-23(29)30)22-19-26-24(20-13-7-5-8-14-20)25(27-22)21-15-9-6-10-16-21/h5-10,13-16,19H,2-4,11-12,17-18H2,1H3,(H,29,30).
What are the key properties of 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid?
8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid has a molecular weight of 403.53 g/mol, XLogP of 5.67, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid is sourced from PubChem (CID 18452661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).