C25H29N3O2 — CID 18452661
8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid (PubChem CID 18452661) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid.
| Compound Name | 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid |
|---|---|
| PubChem CID | 18452661 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 8-[(5,6-diphenylpyrazin-2-yl)-methylamino]octanoic acid |
| SMILES | CN(CCCCCCCC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H29N3O2/c1-28(18-12-4-2-3-11-17-23(29)30)22-19-26-24(20-13-7-5-8-14-20)25(27-22)21-15-9-6-10-16-21/h5-10,13-16,19H,2-4,11-12,17-18H2,1H3,(H,29,30) |
| InChIKey | GKOHHJQMBKJZDT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|