C18H24N4O3 — CID 18453156
N-(2-carbamoylcyclohexyl)-4-(2-oxo-1,3-diazinan-1-yl)benzamide (PubChem CID 18453156) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(2-carbamoylcyclohexyl)-4-(2-oxo-1,3-diazinan-1-yl)benzamide.
| Compound Name | N-(2-carbamoylcyclohexyl)-4-(2-oxo-1,3-diazinan-1-yl)benzamide |
|---|---|
| PubChem CID | 18453156 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(2-carbamoylcyclohexyl)-4-(2-oxo-1,3-diazinan-1-yl)benzamide |
| SMILES | NC(=O)C1CCCCC1NC(=O)c1ccc(N2CCCNC2=O)cc1 |
| InChI | InChI=1S/C18H24N4O3/c19-16(23)14-4-1-2-5-15(14)21-17(24)12-6-8-13(9-7-12)22-11-3-10-20-18(22)25/h6-9,14-15H,1-5,10-11H2,(H2,19,23)(H,20,25)(H,21,24) |
| InChIKey | HPYBRCBWTAGYNN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |