C28H40N6O5 — CID 18462882
2-[6-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]hexanoylamino]-3-(7-ethyl-3-methyl-1-benzofuran-2-yl)propanoic acid (PubChem CID 18462882) has the molecular formula C28H40N6O5 and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-[6-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]hexanoylamino]-3-(7-ethyl-3-methyl-1-benzofuran-2-yl)propanoic acid.
| Compound Name | 2-[6-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]hexanoylamino]-3-(7-ethyl-3-methyl-1-benzofuran-2-yl)propanoic acid |
|---|---|
| PubChem CID | 18462882 |
| Molecular Formula | C28H40N6O5 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-[6-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]hexanoylamino]-3-(7-ethyl-3-methyl-1-benzofuran-2-yl)propanoic acid |
| SMILES | [H]/N=C(\N)N1CC=C(CC(N)C(=O)NCCCCCC(=O)NC(Cc2oc3c(CC)cccc3c2C)C(=O)O)C1 |
| InChI | InChI=1S/C28H40N6O5/c1-3-19-8-7-9-20-17(2)23(39-25(19)20)15-22(27(37)38)33-24(35)10-5-4-6-12-32-26(36)21(29)14-18-11-13-34(16-18)28(30)31/h7-9,11,21-22H,3-6,10,12-16,29H2,1-2H3,(H3,30,31)(H,32,36)(H,33,35)(H,37,38) |
| InChIKey | WTRZIHMRNDAUPM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 187.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|