C22H32N6O7 — CID 18463003
5-[2-[5-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]pentanoylamino]-2-carboxyethyl]-2-methylfuran-3-carboxylic acid (PubChem CID 18463003) has the molecular formula C22H32N6O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is 5-[2-[5-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]pentanoylamino]-2-carboxyethyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[2-[5-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]pentanoylamino]-2-carboxyethyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 18463003 |
| Molecular Formula | C22H32N6O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 5-[2-[5-[[2-amino-3-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)propanoyl]amino]pentanoylamino]-2-carboxyethyl]-2-methylfuran-3-carboxylic acid |
| SMILES | [H]/N=C(\N)N1CC=C(CC(N)C(=O)NCCCCC(=O)NC(Cc2cc(C(=O)O)c(C)o2)C(=O)O)C1 |
| InChI | InChI=1S/C22H32N6O7/c1-12-15(20(31)32)9-14(35-12)10-17(21(33)34)27-18(29)4-2-3-6-26-19(30)16(23)8-13-5-7-28(11-13)22(24)25/h5,9,16-17H,2-4,6-8,10-11,23H2,1H3,(H3,24,25)(H,26,30)(H,27,29)(H,31,32)(H,33,34) |
| InChIKey | QLFNFNXPIPIPGR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 225.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|