C22H30N6O7 — CID 70301305
4-[[5-[[2-amino-3-(2-carbamimidoyl-2,5-dihydro-1H-pyrrol-3-yl)propanoyl]amino]pentanoylamino]-carboxymethyl]-2-hydroxybenzoic acid (PubChem CID 70301305) has the molecular formula C22H30N6O7 and a molecular weight of 490.52 g/mol. Its IUPAC name is 4-[[5-[[2-amino-3-(2-carbamimidoyl-2,5-dihydro-1H-pyrrol-3-yl)propanoyl]amino]pentanoylamino]-carboxymethyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[[5-[[2-amino-3-(2-carbamimidoyl-2,5-dihydro-1H-pyrrol-3-yl)propanoyl]amino]pentanoylamino]-carboxymethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 70301305 |
| Molecular Formula | C22H30N6O7 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 4-[[5-[[2-amino-3-(2-carbamimidoyl-2,5-dihydro-1H-pyrrol-3-yl)propanoyl]amino]pentanoylamino]-carboxymethyl]-2-hydroxybenzoic acid |
| SMILES | [H]/N=C(\N)C1NCC=C1CC(N)C(=O)NCCCCC(=O)NC(C(=O)O)c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C22H30N6O7/c23-14(9-12-6-8-26-17(12)19(24)25)20(31)27-7-2-1-3-16(30)28-18(22(34)35)11-4-5-13(21(32)33)15(29)10-11/h4-6,10,14,17-18,26,29H,1-3,7-9,23H2,(H3,24,25)(H,27,31)(H,28,30)(H,32,33)(H,34,35) |
| InChIKey | HORYYEIPJXWNAI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 240.95 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|