C10H15F3NO2- — CID 18465959
(Z)-3-amino-5-fluoro-4,4-bis(1-fluoroethyl)hex-2-enoate (PubChem CID 18465959) has the molecular formula C10H15F3NO2- and a molecular weight of 238.23 g/mol. Its IUPAC name is (Z)-3-amino-5-fluoro-4,4-bis(1-fluoroethyl)hex-2-enoate.
| Compound Name | (Z)-3-amino-5-fluoro-4,4-bis(1-fluoroethyl)hex-2-enoate |
|---|---|
| PubChem CID | 18465959 |
| Molecular Formula | C10H15F3NO2- |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (Z)-3-amino-5-fluoro-4,4-bis(1-fluoroethyl)hex-2-enoate |
| SMILES | CC(F)C(/C(N)=C/C(=O)[O-])(C(C)F)C(C)F |
| InChI | InChI=1S/C10H16F3NO2/c1-5(11)10(6(2)12,7(3)13)8(14)4-9(15)16/h4-7H,14H2,1-3H3,(H,15,16)/p-1/b8-4- |
| InChIKey | ZBSLPTGNJQGHBU-YWEYNIOJSA-M |
| XLogP | 0.64 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|