About 3-bromo-2-oxobutanoate
3-bromo-2-oxobutanoate (PubChem CID 23470142) has the molecular formula C4H4BrO3-
and a molecular weight of 179.98 g/mol. Its IUPAC name is 3-bromo-2-oxobutanoate.
Molecular Properties
| Compound Name | 3-bromo-2-oxobutanoate |
| PubChem CID | 23470142 |
| Molecular Formula | C4H4BrO3- |
| Molecular Weight | 179.98 g/mol |
| Exact Mass | 178.93 |
| IUPAC Name | 3-bromo-2-oxobutanoate |
| SMILES | CC(Br)C(=O)C(=O)[O-] |
| InChI | InChI=1S/C4H5BrO3/c1-2(5)3(6)4(7)8/h2H,1H3,(H,7,8)/p-1 |
| InChIKey | YQKNRMUYNFVEGP-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.98 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-oxobutanoate?
The IUPAC name of 3-bromo-2-oxobutanoate (CID 23470142) is 3-bromo-2-oxobutanoate.
What is the SMILES notation for 3-bromo-2-oxobutanoate?
The canonical SMILES for 3-bromo-2-oxobutanoate is CC(Br)C(=O)C(=O)[O-].
What is the InChIKey of 3-bromo-2-oxobutanoate?
The InChIKey is YQKNRMUYNFVEGP-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H5BrO3/c1-2(5)3(6)4(7)8/h2H,1H3,(H,7,8)/p-1.
What are the key properties of 3-bromo-2-oxobutanoate?
3-bromo-2-oxobutanoate has a molecular weight of 179.98 g/mol, XLogP of -0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-oxobutanoate is sourced from PubChem (CID 23470142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).